| Nom | Wherryite |
| └─ Allemand (de) | Wherryit |
| └─ Anglais (en) | Wherryite |
| └─ Espagnol (es) | Wherryíta |
| └─ Français (fr) | Wherryite |
| └─ Russe (ru) | Уэрриит |
| Origine | Named for Edgar T. Wherry (1885-1982), American mineralogist and plant ecologist. |
| Statut | G ▶ Hérité |
| Nom | Wherryite |
| Code | 1950 |
| Symbole | Whr |
| Formule | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| Pays | USA |
| Météorite | Non |
| Référence 1 | American Mineralogist 35 (1950), 93 |
| Référence 2 | Canadian Mineralogist 32 (1994), 373 |
| Archive | 2025-11 |
| Webmineral | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| Mineralienatlas | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| Mineralienatlas (Empirique) | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| Rruff | Pb2+7Cu2+2(S6+O4)4(SiO4)2(OH)2 |
| Formule de référence | Pb7Cu2(SO4)4(SiO4)2(OH)2 |
| Masse atomique (u ≡ Da) | 2180.0032 |
| Masse molaire #1 (g.mol-1) | 2180.0032 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 2.00 | 4.65 | 1.00797500 | 2.01595000 | 0.09 |
| O | 26.00 | 60.47 | 15.99940000 | 415.98440000 | 19.08 |
| Si | 2.00 | 4.65 | 28.08510000 | 56.17020000 | 2.58 |
| S | 4.00 | 9.30 | 32.06750000 | 128.27000000 | 5.88 |
| Cu | 2.00 | 4.65 | 63.54630000 | 127.09260000 | 5.83 |
| Pb | 7.00 | 16.28 | 207.21000000 | 1450.47000000 | 66.54 |
| Total | 43.00 | 100.00 | 2180.00315000 | 100.00 |
| Dureté de Mohs | |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 5.82 |
| Indice de fermions | 0,14 |
| Indice de bosons | 0,86 |
| Photoélectricité | |
| └─ PEWherryite (barns/électron) | 1 160,7 |
| └─ U #2 (barns/cm3) | 6 755,274 |
| GRapi #3 | 0 |
| Strunz 9ed. | 07 ▶ Sulfates, sélénates, tellurates, chromates, molybdates, tungstates └─ 07.B ▶ Sulfates (selenates, etc.) avec anions additionnels, sans H2O └─ 07.BC ▶ Avec medium-sized and large cations └─ 07.BC.55 ▶ Wherryite |
| Dana 8ed. | 32 ▶ Compound Sulfates └─ 32.03 ▶ Compound Sulfates (Anhydres) avec poly-anionic formula └─ 32.03.03 ▶ (Indéfini) └─ 32.03.03.01 ▶ Wherryite |
| CIM Hey's | |
| Lapis | VIII ▶ Silicates └─ VIII/B ▶ Inselsilicates avec anions étrangers au tétraèdre (néso-subsilikates) └─ VIII/B.28 ▶ Cations avec nombres de coordination entre [8] et [12] ; silicates en îlots avec groupes [SO4]2-, [CrO4]2- et [PO4]3- └─ VIII/B.28-025 ▶ Wherryite |
| Hölzel | 7 ▶ Sulfates, chromates, molybdates, wolframates, tellurates └─ 7.B ▶ Sulfates (sélénates, etc.) avec autres anions, sans H2O └─ 7.BA.3 ▶ Avec Cu + Pb └─ 7.BA.380 ▶ Wherryite |
| Système cristallin | Monoclinique |
| └─ Notation Hermann–Mauguin | 2/m |
| └─ Règles longueurs | a ≠ b ≠ c |
| └─ Règles angles | α = γ = 90°, β ≠ 90° |
| Classe cristalline | Monoclinique dipyramidal #5 |
| └─ Notation Hermann–Mauguin | 2/m |
| └─ Notation Schoenflies | C2h |
| └─ Axes binaires (180°) | 1 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 1 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | 12 |
| └─ Notation Hermann–Mauguin | C2/m |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 20.789 |
| └─ b (Å) | 5.787 |
| └─ c (Å) | 9.142 |
| Rapport | |
| └─ Rapport a/b | 3.592 |
| └─ Rapport c/a | 0.440 |
| └─ Rapport c/b | 1.580 |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 91.23 |
| └─ γ (°) | 90 |
| Z #1 | 2 |
| Volume (calculé) #2 (Å3) | 1099.584 |
| Densité (calculé) ρ #3 (g/cm3) | 6.584 |
| Système cristallin | Monoclinique |
| └─ Angle 2V | Biaxe (-) |
| └─ Angle (°) | 50° |
| └─ Anisotropie | Oui |
| └─ Biréfringence Maxi. | 0.082 |
| └─ Absorption (X/Y/Z) | |
| └─ Pléochroïsme | |
| └─ Pléochroïsme X | |
| └─ Pléochroïsme Y | |
| └─ Pléochroïsme Z | |
| └─ Indice moyen | 1,992 |
| └─ Indice α / ω / n | 1,942 |
| └─ Indice β | 2,01 |
| └─ Indice γ / ε | 2,024 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.1498 |
| └─ KPD calculé | 0.1463 |
| └─ CI #2 calculé | 0,023 ▶ Bon |
| └─ KPD mesuré | 0.1538 |
| └─ CI #2 mesuré | -0,027 ▶ Supérieur |
| └─ N calculé | 1.97 - 2.02 |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/wherryite.pdf |
| Mindat | http://www.mindat.org/show.php?name=wherryite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=wherryite |
| RRUFF | https://rruff.net/wherryite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?wherryite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=w |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/wherryite_foto.html |
| Webmineral | https://webmineral.com/data/Wherryite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/wherryite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=wherryite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/wherryite |
| Gem Select | https://www.gemselect.com/wherryite/wherryite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=wherryite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/wherryite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/wherryite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=wherryite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=wherryite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=wherryite |