| Nom | Xiangjiangite |
| └─ Allemand (de) | Xiangjiangit |
| └─ Anglais (en) | Xiangjiangite |
| └─ Espagnol (es) | Xiangjiangita |
| └─ Français (fr) | Xiangjiangite |
| Origine | Named after the locality. LOCALITY: Xiangjiang River, Hunan, China. |
| Statut | A ▶ Approuvé |
| Nom | Xiangjiangite |
| Code | 1982 s.p. |
| Symbole | Xjg |
| Formule | Fe3+(UO2)4(PO4)2(SO4)2(OH) • 22H2O |
| Pays | CHN |
| Météorite | Non |
| Référence 1 | Scientia Geologica Sinica 2 (1978), 183 |
| Archive | 2025-11 |
| Webmineral | (Fe+++,Al)(UO2)4(PO4)2(SO4)2(OH) |
| Mineralienatlas | (Fe3+,Al)[(UO2)4|OH|(SO4)2|(PO4)2] • 22H2O |
| Mineralienatlas (Empirique) | (Fe0.75Al0.25)[(UO2)4OH(SO4)2(PO4)2] • 22H2O |
| Rruff | Fe3+(U6+O2)4(PO4)2(S6+O4)2(OH) • 22H2O |
| Formule de référence | (Fe0.75Al0.25)[(UO2)4OH(SO4)2(PO4)2] • 22H2O |
| Masse atomique (u ≡ Da) | 1924.1581 |
| Masse molaire #1 (g.mol-1) | 1924.1581 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 45.00 | 44.55 | 1.00797500 | 45.35887500 | 2.36 |
| O | 47.00 | 46.53 | 15.99940000 | 751.97180000 | 39.08 |
| Al | 0.25 | 0.25 | 26.98153850 | 6.74538463 | 0.35 |
| P | 2.00 | 1.98 | 30.97376200 | 61.94752400 | 3.22 |
| S | 2.00 | 1.98 | 32.06750000 | 64.13500000 | 3.33 |
| Fe | 0.75 | 0.74 | 55.84520000 | 41.88390000 | 2.18 |
| U | 4.00 | 3.96 | 238.02891000 | 952.11564000 | 49.48 |
| Total | 101.00 | 100.00 | 1924.15812363 | 100.00 |
| Dureté de Mohs | 1 - 2 |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 3.15 |
| Indice de fermions | 0,0043 |
| Indice de bosons | 0,9957 |
| Photoélectricité | |
| └─ PEXiangjiangite (barns/électron) | 1 241,69 |
| └─ U #2 (barns/cm3) | 3 911,3235 |
| GRapi #3 | 3 845 084,01 |
| Strunz 9ed. | 08 ▶ Phosphates, arséniates, vanadates └─ 08.E ▶ Uranyl Phosphates and Arsenates └─ 08.EB ▶ UO2 : RO4 = 1:1 └─ 08.EB.05 ▶ Xiangjiangite |
| Dana 8ed. | 43 ▶ Compound Phosphates, etc └─ 43.05 ▶ Compound Phosphates, etc (Hydratés Anions composés avec Hydroxyle ou Halogène) └─ 43.05.06 ▶ (Indéfini) └─ 43.05.06.01 ▶ Xiangjiangite |
| CIM Hey's | 22 ▶ Phosphates, Arsenates ou Vanadates avec d'autres anions └─ 22.03 ▶ Phosphates, arsenates ou vanadates avec sulphates └─ 22.03.31 ▶ Xiangjiangite |
| Lapis | VII ▶ Phosphates et arsénates (« phosphates » incluent toujours les arsénates et les vanadates isotypes) └─ VII/E ▶ Uranyl-phosphates/arsénates et uranyl-vanadates avec [UO2]2+ – [PO4]/[AsO4]3− et [UO2]2+ – [V2O8]6− (série de Sincosite) └─ VII/E.06 ▶ (Indéfini) └─ VII/E.06-030 ▶ Xiangjiangite |
| Hölzel | 8 ▶ Phosphates, arsénates, vanadates └─ 8.E ▶ Uranyl-phosphates, -arsénates, -vanadates └─ 8.EA.1 ▶ C petits-moyens : Groupe Novacekite–Zeunerite └─ 8.EA.120 ▶ Xiangjiangite |
| Système cristallin | |
| └─ Notation Hermann–Mauguin | |
| └─ Règles longueurs | |
| └─ Règles angles | |
| Classe cristalline | |
| └─ Notation Hermann–Mauguin | |
| └─ Notation Schoenflies | |
| └─ Axes binaires (180°) | 0 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 0 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | |
| └─ Notation Hermann–Mauguin | |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 7.17 |
| └─ b (Å) | (Indéfini) |
| └─ c (Å) | 22.22 |
| Rapport | |
| └─ Rapport a/b | |
| └─ Rapport c/a | 3.099 |
| └─ Rapport c/b | |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 90 |
| └─ γ (°) | 120 |
| Z #1 | 1 |
| Volume (calculé) #2 (Å3) | |
| Densité (calculé) ρ #3 (g/cm3) |
| Système cristallin | |
| └─ Angle 2V | (-) |
| └─ Angle (°) | 87° |
| └─ Anisotropie | Non |
| └─ Biréfringence Maxi. | 0.035 |
| └─ Absorption | Aucune |
| └─ Pléochroïsme | Aucun |
| └─ Pléochroïsme X | Aucun |
| └─ Pléochroïsme Y | Aucun |
| └─ Pléochroïsme Z | Aucun |
| └─ Indice moyen | 1,576 |
| └─ Indice α / ω / n | 1,558 |
| └─ Indice β | 1,576 |
| └─ Indice γ / ε | 1,593 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.1659 |
| └─ KPD calculé | 0.1659 |
| └─ CI #2 calculé | 0 ▶ Supérieur |
| └─ KPD mesuré | 0.1919 |
| └─ CI #2 mesuré | -0,157 ▶ Supérieur |
| └─ N calculé | 1.48 - 1.58 |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/xiangjiangite.pdf |
| Mindat | http://www.mindat.org/show.php?name=xiangjiangite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=xiangjiangite |
| RRUFF | https://rruff.net/xiangjiangite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?xiangjiangite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=x |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/xiangjiangite_foto.html |
| Webmineral | https://webmineral.com/data/Xiangjiangite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/xiangjiangite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=xiangjiangite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/xiangjiangite |
| Gem Select | https://www.gemselect.com/xiangjiangite/xiangjiangite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=xiangjiangite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/xiangjiangite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/xiangjiangite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=xiangjiangite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=xiangjiangite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=xiangjiangite |