| Nom | Diadochite |
| └─ Allemand (de) | Diadochit |
| └─ Allemand (de) | Phosphoreisensinter |
| └─ Anglais (en) | Diadochite |
| └─ Anglais (en) | Orthodiadochite |
| └─ Espagnol (es) | Diadochita |
| └─ Espagnol (es) | Diadoquita |
| └─ Russe (ru) | Диадохит |
| Origine | From the Greek, diadochos, meaning "successor," presumably in allusion to its secondary origin. |
| Statut | G ▶ Hérité |
| Nom | Diadochite |
| Code | 1837 |
| Symbole | Ddc |
| Formule | Fe3+2(PO4)(SO4)(OH)(H2O)5 • H2O |
| Pays | DEU |
| Météorite | Non |
| Référence 1 | Journal für Praktische Chemie 10 (1837), 503 |
| Référence 2 | Clays and Clay Minerals 47 (1999), 1 |
| Archive | 2025-11 |
| Webmineral | Fe+++2(PO4)(SO4)(OH) |
| Mineralienatlas | Fe23+(PO4)(SO4)(OH) • 5H2O |
| Mineralienatlas (Empirique) | Fe2(PO4)(SO4)(OH) • 5H2O |
| Rruff | Fe3+2(PO4)(S6+O4)(OH) • 6H2O |
| Formule de référence | Fe2(PO4)(SO4)(OH) • 5H2O |
| Masse atomique (u ≡ Da) | 409.811 |
| Masse molaire #1 (g.mol-1) | 409.811 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 11.00 | 37.93 | 1.00797500 | 11.08772500 | 2.71 |
| O | 14.00 | 48.28 | 15.99940000 | 223.99160000 | 54.66 |
| P | 1.00 | 3.45 | 30.97376200 | 30.97376200 | 7.56 |
| S | 1.00 | 3.45 | 32.06750000 | 32.06750000 | 7.82 |
| Fe | 2.00 | 6.90 | 55.84520000 | 111.69040000 | 27.25 |
| Total | 29.00 | 100.00 | 409.81098700 | 100.00 |
| Dureté de Mohs | 3 - 4 |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 2.22 |
| Indice de fermions | 0,0064 |
| Indice de bosons | 0,9936 |
| Photoélectricité | |
| └─ PEDiadochite (barns/électron) | 8,42 |
| └─ U #2 (barns/cm3) | 18,6924 |
| GRapi #3 | 0 |
| Strunz 9ed. | 08 ▶ Phosphates, arséniates, vanadates └─ 08.D ▶ Phosphates, etc └─ 08.DB ▶ Avec only medium-sized cations, (OH, etc) : RO4 < 1:1 └─ 08.DB.05 ▶ Diadochite |
| Dana 8ed. | 43 ▶ Compound Phosphates, etc └─ 43.05 ▶ Compound Phosphates, etc (Hydratés Anions composés avec Hydroxyle ou Halogène) └─ 43.05.02 ▶ (Indéfini) └─ 43.05.02.01 ▶ Diadochite |
| CIM Hey's | 22 ▶ Phosphates, Arsenates ou Vanadates avec d'autres anions └─ 22.03 ▶ Phosphates, arsenates ou vanadates avec sulphates └─ 22.03.25 ▶ Diadochite |
| Lapis | VII ▶ Phosphates et arsénates (« phosphates » incluent toujours les arsénates et les vanadates isotypes) └─ VII/D ▶ Phosphates hydratés, avec anions étrangers └─ VII/D.05 ▶ Cations moyens : Cu–Zn–Mn–Al–Fe └─ VII/D.05-020 ▶ Diadochite |
| Hölzel | 8 ▶ Phosphates, arsénates, vanadates └─ 8.D ▶ Phosphates avec autres anions, avec H2O └─ 8.DC.5 ▶ Avec autres anions complexes, OH/XO4 = 1/2 Groupe de la Diadochite └─ 8.DC.500 ▶ Diadochite |
| Système cristallin | |
| └─ Notation Hermann–Mauguin | |
| └─ Règles longueurs | |
| └─ Règles angles | |
| Classe cristalline | |
| └─ Notation Hermann–Mauguin | |
| └─ Notation Schoenflies | |
| └─ Axes binaires (180°) | 0 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 0 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | |
| └─ Notation Hermann–Mauguin | |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | (Indéfini) |
| └─ b (Å) | (Indéfini) |
| └─ c (Å) | (Indéfini) |
| Rapport | |
| └─ Rapport a/b | |
| └─ Rapport c/a | |
| └─ Rapport c/b | |
| Angles | |
| └─ α (°) | (Indéfini) |
| └─ β (°) | (Indéfini) |
| └─ γ (°) | (Indéfini) |
| Z #1 | |
| Volume (calculé) #2 (Å3) | |
| Densité (calculé) ρ #3 (g/cm3) |
| Système cristallin | |
| └─ Angle 2V | (+) |
| └─ Angle mesuré (°) | 55° |
| └─ Anisotropie | Non |
| └─ Biréfringence Maxi. | 0.050 |
| └─ Absorption | Aucune |
| └─ Pléochroïsme | Aucun |
| └─ Pléochroïsme X | Aucun |
| └─ Pléochroïsme Y | Aucun |
| └─ Pléochroïsme Z | Aucun |
| └─ Indice moyen | 1,636 |
| └─ Indice α / ω / n | 1,615 - 1,618 |
| └─ Indice β | 1,618 - 1,627 |
| └─ Indice γ / ε | 1,665 - 1,670 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.2741 |
| └─ KPD calculé | 0.2592 |
| └─ CI #2 calculé | 0,054 ▶ Correct |
| └─ KPD mesuré | 0.2886 |
| └─ CI #2 mesuré | -0,053 ▶ Supérieur |
| └─ N calculé | 1.55 - 1.67 |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/diadochite.pdf |
| Mindat | http://www.mindat.org/show.php?name=diadochite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=diadochite |
| RRUFF | https://rruff.net/diadochite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?diadochite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=d |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/diadochite_foto.html |
| Webmineral | https://webmineral.com/data/Diadochite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/diadochite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=diadochite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/diadochite |
| Gem Select | https://www.gemselect.com/diadochite/diadochite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=diadochite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/diadochite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/diadochite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=diadochite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=diadochite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=diadochite |