| Nom | Voggite |
| └─ Allemand (de) | Voggit |
| └─ Anglais (en) | Voggite |
| └─ Espagnol (es) | Voggita |
| └─ Français (fr) | Voggite |
| └─ IMA (im) | IMA1988-037 |
| └─ Russe (ru) | Воггит |
| Origine | Named for for Adolf Vogg who first discovered the mineral. |
| Statut | A ▶ Approuvé |
| Nom | Voggite |
| Code | 1988-037 |
| Symbole | Vog |
| Formule | Na2Zr(PO4)(CO3)(OH)(H2O)2 |
| Pays | CAN |
| Météorite | Non |
| Référence 1 | Canadian Mineralogist 28 (1990), 155 |
| Référence 2 | Mineralogical Magazine 54 (1990), 495 |
| Archive | 2025-11 |
| Webmineral | Na2Zr(PO4)(CO3)(OH) |
| Mineralienatlas | Na2Zr(PO4)(CO3)(OH) • 2H2O |
| Mineralienatlas (Empirique) | Na2Zr(PO4)(CO3)(OH) • 2H2O |
| Rruff | Na2Zr4+(PO4)(CO3)(OH) • 2H2O |
| Formule de référence | Na2Zr(PO4)(CO3)(OH) • 2H2O |
| Masse atomique (u ≡ Da) | 345.222 |
| Masse molaire #1 (g.mol-1) | 345.222 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 5.00 | 25.00 | 1.00797500 | 5.03987500 | 1.46 |
| C | 1.00 | 5.00 | 12.01060000 | 12.01060000 | 3.48 |
| O | 10.00 | 50.00 | 15.99940000 | 159.99400000 | 46.35 |
| Na | 2.00 | 10.00 | 22.98976928 | 45.97953856 | 13.32 |
| P | 1.00 | 5.00 | 30.97376200 | 30.97376200 | 8.97 |
| Zr | 1.00 | 5.00 | 91.22420000 | 91.22420000 | 26.42 |
| Total | 20.00 | 100.00 | 345.22197556 | 100.00 |
| Dureté de Mohs | |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 2.63 |
| Indice de fermions | 0,03 |
| Indice de bosons | 0,97 |
| Photoélectricité | |
| └─ PEVoggite (barns/électron) | 35,63 |
| └─ U #2 (barns/cm3) | 93,7069 |
| GRapi #3 | 0 |
| Strunz 9ed. | 08 ▶ Phosphates, arséniates, vanadates └─ 08.D ▶ Phosphates, etc └─ 08.DO ▶ Avec CO3, SO4, SiO4 └─ 08.DO.10 ▶ Voggite |
| Dana 8ed. | 43 ▶ Compound Phosphates, etc └─ 43.05 ▶ Compound Phosphates, etc (Hydratés Anions composés avec Hydroxyle ou Halogène) └─ 43.05.16 ▶ (Indéfini) └─ 43.05.16.01 ▶ Voggite |
| CIM Hey's | |
| Lapis | VII ▶ Phosphates et arsénates (« phosphates » incluent toujours les arsénates et les vanadates isotypes) └─ VII/D ▶ Phosphates hydratés, avec anions étrangers └─ VII/D.41 ▶ Cations moyens et très gros : Al–Mg et Ca–Na–K └─ VII/D.41-010 ▶ Voggite |
| Hölzel | 8 ▶ Phosphates, arsénates, vanadates └─ 8.D ▶ Phosphates avec autres anions, avec H2O └─ 8.DI.4 ▶ Avec autres anions └─ 8.DI.430 ▶ Voggite |
| Système cristallin | Monoclinique |
| └─ Notation Hermann–Mauguin | 2/m |
| └─ Règles longueurs | a ≠ b ≠ c |
| └─ Règles angles | α = γ = 90°, β ≠ 90° |
| Classe cristalline | Monoclinique dipyramidal #5 |
| └─ Notation Hermann–Mauguin | 2/m |
| └─ Notation Schoenflies | C2h |
| └─ Axes binaires (180°) | 1 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 1 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | 12 |
| └─ Notation Hermann–Mauguin | C2/m └─ I2/m |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 12.251 |
| └─ b (Å) | 6.557 |
| └─ c (Å) | 11.755 |
| Rapport | |
| └─ Rapport a/b | 1.868 |
| └─ Rapport c/a | 0.960 |
| └─ Rapport c/b | 1.793 |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 116.12 |
| └─ γ (°) | 90 |
| Z #1 | 4 |
| Volume (calculé) #2 (Å3) | 847.842 |
| Densité (calculé) ρ #3 (g/cm3) | 2.705 |
| Système cristallin | Monoclinique |
| └─ Angle 2V | Biaxe (+) |
| └─ Angle (°) | 81° |
| └─ Anisotropie | Oui |
| └─ Biréfringence Maxi. | 0.063 |
| └─ Absorption (X/Y/Z) | |
| └─ Pléochroïsme | |
| └─ Pléochroïsme X | |
| └─ Pléochroïsme Y | |
| └─ Pléochroïsme Z | |
| └─ Indice moyen | 1,595 |
| └─ Indice α / ω / n | 1,569 |
| └─ Indice β | 1,594 |
| └─ Indice γ / ε | 1,622 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.2183 |
| └─ KPD calculé | 0.2204 |
| └─ CI #2 calculé | -0,01 ▶ Supérieur |
| └─ KPD mesuré | 0.2204 |
| └─ CI #2 mesuré | -0,01 ▶ Supérieur |
| └─ N calculé | |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/voggite.pdf |
| Mindat | http://www.mindat.org/show.php?name=voggite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=voggite |
| RRUFF | https://rruff.net/voggite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?voggite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=v |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/voggite_foto.html |
| Webmineral | https://webmineral.com/data/Voggite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/voggite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=voggite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/voggite |
| Gem Select | https://www.gemselect.com/voggite/voggite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=voggite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/voggite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/voggite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=voggite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=voggite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=voggite |