| Nom | Iranite |
| └─ Allemand (de) | Iranit |
| └─ Anglais (en) | Iranite |
| └─ Anglais (en) | Khuniite |
| └─ Chinois (zh) | 水鉻鉛礦 |
| └─ Chinois (zh) | 水铬铅矿 |
| └─ Espagnol (es) | Iranita |
| └─ Français (fr) | Iranite |
| └─ Russe (ru) | Иранит |
| Origine | Name for the country. |
| Statut | A ▶ Approuvé |
| Nom | Iranite |
| Code | 1980 s.p. |
| Symbole | Irn |
| Formule | CuPb10(CrO4)6(SiO4)2(OH)2 |
| Pays | IRN |
| Météorite | Non |
| Référence 1 | Bulletin de la Société Française de Minéralogie et de Cristallographie 86 (1963), 133 |
| Référence 2 | Acta Crystallographica C63 (2007), i122 |
| Archive | 2025-11 |
| Webmineral | Pb10Cu(CrO4)6(SiO4)2(F,OH)2 |
| Mineralienatlas | Pb10Cu(CrO4)6(SiO4)2(F,OH)2 |
| Mineralienatlas (Empirique) | Pb10Cu(CrO4)6(SiO4)2(F0.75(OH)0.25)2 |
| Rruff | Pb2+10Cu2+(Cr6+O4)6(SiO4)2(OH)2 |
| Formule de référence | Pb10Cu(CrO4)6(SiO4)2(F0.75(OH)0.25)2 |
| Masse atomique (u ≡ Da) | 3052.7756 |
| Masse molaire #1 (g.mol-1) | 3052.7756 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 0.50 | 0.93 | 1.00797500 | 0.50398750 | 0.02 |
| O | 32.50 | 60.75 | 15.99940000 | 519.98050000 | 17.03 |
| F | 1.50 | 2.80 | 18.99840316 | 28.49760474 | 0.93 |
| Si | 2.00 | 3.74 | 28.08510000 | 56.17020000 | 1.84 |
| Cr | 6.00 | 11.21 | 51.99616000 | 311.97696000 | 10.22 |
| Cu | 1.00 | 1.87 | 63.54630000 | 63.54630000 | 2.08 |
| Pb | 10.00 | 18.69 | 207.21000000 | 2072.10000000 | 67.88 |
| Total | 53.50 | 100.00 | 3052.77555224 | 100.00 |
| Dureté de Mohs | |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 5.30 |
| Indice de fermions | 0,16 |
| Indice de bosons | 0,84 |
| Photoélectricité | |
| └─ PEIranite (barns/électron) | 1 231,83 |
| └─ U #2 (barns/cm3) | 6 528,699 |
| GRapi #3 | 0 |
| Strunz 9ed. | 07 ▶ Sulfates, sélénates, tellurates, chromates, molybdates, tungstates └─ 07.F ▶ Chromates └─ 07.FC ▶ Avec PO4, AsO4, SiO4 └─ 07.FC.15 ▶ Iranite |
| Dana 8ed. | 36 ▶ Compound Chromates └─ 36.01 ▶ Compound Chromates avec formules diverses └─ 36.01.01 ▶ (Indéfini) └─ 36.01.01.01 ▶ Iranite |
| CIM Hey's | |
| Lapis | VIII ▶ Silicates └─ VIII/B ▶ Inselsilicates avec anions étrangers au tétraèdre (néso-subsilikates) └─ VIII/B.28 ▶ Cations avec nombres de coordination entre [8] et [12] ; silicates en îlots avec groupes [SO4]2-, [CrO4]2- et [PO4]3- └─ VIII/B.28-010 ▶ Iranite |
| Hölzel | 7 ▶ Sulfates, chromates, molybdates, wolframates, tellurates └─ 7.F ▶ Chromates └─ 7.FB.2 ▶ (Indéfini) └─ 7.FB.270 ▶ Iranite |
| Système cristallin | Triclinique |
| └─ Notation Hermann–Mauguin | 1 |
| └─ Règles longueurs | a ≠ b ≠ c |
| └─ Règles angles | α ≠ β ≠ γ ≠ 90° |
| Classe cristalline | Asymétrique #5 |
| └─ Notation Hermann–Mauguin | 1 |
| └─ Notation Schoenflies | C1 |
| └─ Axes binaires (180°) | 1 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 0 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | 1 |
| └─ Notation Hermann–Mauguin | P1 |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 10.02 |
| └─ b (Å) | 9.54 |
| └─ c (Å) | 9.89 |
| Rapport | |
| └─ Rapport a/b | 1.050 |
| └─ Rapport c/a | 0.987 |
| └─ Rapport c/b | 1.037 |
| Angles | |
| └─ α (°) | 104.50 |
| └─ β (°) | 66 |
| └─ γ (°) | 108.50 |
| Z #1 | 1 |
| Volume (calculé) #2 (Å3) | 810.958 |
| Densité (calculé) ρ #3 (g/cm3) | 6.251 |
| Système cristallin | Triclinique |
| └─ Angle 2V | Biaxe (+) |
| └─ Anisotropie | Oui |
| └─ Biréfringence Maxi. | 0.170 |
| └─ Absorption (X/Y/Z) | |
| └─ Pléochroïsme | |
| └─ Pléochroïsme X | |
| └─ Pléochroïsme Y | |
| └─ Pléochroïsme Z | |
| └─ Indice moyen | 2,365 |
| └─ Indice α / ω / n | 2,28 |
| └─ Indice β | 2,365 |
| └─ Indice γ / ε | 2,45 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.1777 |
| └─ KPD calculé | 0.216 |
| └─ CI #2 calculé | -0,216 ▶ Supérieur |
| └─ KPD mesuré | 0.2328 |
| └─ CI #2 mesuré | -0,31 ▶ Supérieur |
| └─ N calculé | 2.03 - 2.11 |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | Verdâtre |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/iranite.pdf |
| Mindat | http://www.mindat.org/show.php?name=iranite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=iranite |
| RRUFF | https://rruff.net/iranite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?iranite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=i |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/iranite_foto.html |
| Webmineral | https://webmineral.com/data/Iranite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/iranite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=iranite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/iranite |
| Gem Select | https://www.gemselect.com/iranite/iranite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=iranite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/iranite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/iranite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=iranite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=iranite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=iranite |