| Nom | Pattersonite |
| └─ Allemand (de) | Pattersonit |
| └─ Anglais (en) | Pattersonite |
| └─ Chinois (zh) | 帕特森石 |
| └─ IMA (im) | IMA2005-049 |
| Origine | Named for Arthur Lindo Patterson (1902-1966), a crystallographer who developed a method employing a Fourier series to generate a three-dimensional function, the now well-known "Patterson function" in crystal-structure determination. |
| Statut | A ▶ Approuvé |
| Nom | Pattersonite |
| Code | 2005-049 |
| Symbole | Patt |
| Formule | PbFe3(PO4)2(OH)5(H2O) |
| Pays | DEU |
| Météorite | Non |
| Référence 1 | European Journal of Mineralogy 20 (2008), 281 |
| Archive | 2025-11 |
| Webmineral | PbFe3(PO4)2(OH)4(H2O,OH)2 |
| Mineralienatlas | PbFe3(PO4)2(OH)4(H2O,OH)2 |
| Mineralienatlas (Empirique) | PbFe3(PO4)2(OH)4((H2O)0.75(OH)0.25)2 |
| Rruff | Pb2+Fe3+3(PO4)2(OH)5 • H2O |
| Formule de référence | PbFe3(PO4)2(OH)4((H2O)0.75(OH)0.25)2 |
| Masse atomique (u ≡ Da) | 668.2445 |
| Masse molaire #1 (g.mol-1) | 668.2445 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 7.50 | 27.27 | 1.00797500 | 7.55981250 | 1.13 |
| O | 14.00 | 50.91 | 15.99940000 | 223.99160000 | 33.52 |
| P | 2.00 | 7.27 | 30.97376200 | 61.94752400 | 9.27 |
| Fe | 3.00 | 10.91 | 55.84520000 | 167.53560000 | 25.07 |
| Pb | 1.00 | 3.64 | 207.21000000 | 207.21000000 | 31.01 |
| Total | 27.50 | 100.00 | 668.24453650 | 100.00 |
| Dureté de Mohs | 4,5 |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 3.86 |
| Indice de fermions | 0,07 |
| Indice de bosons | 0,93 |
| Photoélectricité | |
| └─ PEPattersonite (barns/électron) | 523,02 |
| └─ U #2 (barns/cm3) | 2 018,8572 |
| GRapi #3 | 0 |
| Strunz 9ed. | 08 ▶ Phosphates, arséniates, vanadates └─ 08.B ▶ Phosphates, etc. avec anions additionnels, sans H2O └─ 08.BL ▶ Avec medium-sized and large cations, (OH, etc) : RO4 = 3:1 └─ 08.BL.25 ▶ Pattersonite |
| Dana 8ed. | |
| CIM Hey's | |
| Lapis | VII ▶ Phosphates et arsénates (« phosphates » incluent toujours les arsénates et les vanadates isotypes) └─ VII/B ▶ Phosphates anhydres, avec anions étrangers F, Cl, O, OH └─ VII/B.36 ▶ Cations moyens et gros : Mg–Cu–Zn et Ca–Na–K–Ba–Pb ; groupe du crandallite └─ VII/B.36-164 ▶ Pattersonite |
| Hölzel | 8 ▶ Phosphates, arsénates, vanadates └─ 8.B ▶ Phosphates, etc., avec autres anions, sans H2O └─ 8.BK.2 ▶ Avec Pb — Groupe de la Plumbogummite └─ 8.BK.215 ▶ Pattersonite |
| Système cristallin | Triclinique |
| └─ Notation Hermann–Mauguin | 1 |
| └─ Règles longueurs | a ≠ b ≠ c |
| └─ Règles angles | α ≠ β ≠ γ ≠ 90° |
| Classe cristalline | Centro-symétrique #5 |
| └─ Notation Hermann–Mauguin | 1 |
| └─ Notation Schoenflies | Ci ≡ S2 |
| └─ Axes binaires (180°) | 0 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | ≥1 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | 2 |
| └─ Notation Hermann–Mauguin | P1 |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 5.307 |
| └─ b (Å) | 7.209 |
| └─ c (Å) | 7.349 |
| Rapport | |
| └─ Rapport a/b | 0.736 |
| └─ Rapport c/a | 1.385 |
| └─ Rapport c/b | 1.019 |
| Angles | |
| └─ α (°) | 87.75 |
| └─ β (°) | 86.37 |
| └─ γ (°) | 71.42 |
| Z #1 | 1 |
| Volume (calculé) #2 (Å3) | 265.916 |
| Densité (calculé) ρ #3 (g/cm3) | 4.173 |
| Système cristallin | Triclinique |
| └─ Angle 2V | Biaxe (-) |
| └─ Angle (°) | 50° |
| └─ Anisotropie | Oui |
| └─ Biréfringence Maxi. | 0.070 |
| └─ Absorption (X/Y/Z) | |
| └─ Pléochroïsme | |
| └─ Pléochroïsme X | |
| └─ Pléochroïsme Y | |
| └─ Pléochroïsme Z | |
| └─ Indice moyen | 1,902 |
| └─ Indice α / ω / n | 1,86 |
| └─ Indice β | 1,917 |
| └─ Indice γ / ε | 1,93 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.1317 |
| └─ KPD calculé | 0.2164 |
| └─ CI #2 calculé | -0,643 ▶ Supérieur |
| └─ KPD mesuré | 0.2233 |
| └─ CI #2 mesuré | -0,696 ▶ Supérieur |
| └─ N calculé | 1.53 - 1.55 |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/pattersonite.pdf |
| Mindat | http://www.mindat.org/show.php?name=pattersonite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=pattersonite |
| RRUFF | https://rruff.net/pattersonite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?pattersonite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=p |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/pattersonite_foto.html |
| Webmineral | https://webmineral.com/data/Pattersonite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/pattersonite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=pattersonite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/pattersonite |
| Gem Select | https://www.gemselect.com/pattersonite/pattersonite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=pattersonite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/pattersonite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/pattersonite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=pattersonite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=pattersonite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=pattersonite |