| Nom | Hemihedrite |
| └─ Allemand (de) | Hemihedrit |
| └─ Anglais (en) | Hemihedrite |
| └─ Espagnol (es) | Hemiedrita |
| └─ Espagnol (es) | Hemihedrita |
| └─ Français (fr) | Hemihedrite |
| └─ IMA (im) | IMA1967-011 |
| └─ Russe (ru) | Гемиэдрит |
| Origine | Named for its hemihedral crystal morphology. |
| Statut | A ▶ Approuvé |
| Nom | Hemihedrite |
| Code | 1967-011 |
| Symbole | Hhe |
| Formule | ZnPb10(CrO4)6(SiO4)2(OH)2 |
| Pays | USA |
| Météorite | Non |
| Référence 1 | American Mineralogist 55 (1970), 1088 |
| Référence 2 | Mineralogical Magazine 81 (2017), 1021 |
| Archive | 2025-11 |
| Webmineral | Pb10Zn(CrO4)6(SiO4)2F2 |
| Mineralienatlas | ZnPb10(CrO4)6(SiO4)2(OH)2 |
| Mineralienatlas (Empirique) | Pb10.05(Zn0.91Mg0.02)(Cr5.98S0.01P0.01)Si1.97O34H2.16 |
| Rruff | Pb2+10Zn2+(Cr6+O4)6(SiO4)2(OH)2 |
| Formule de référence | Pb10.05(Zn0.91Mg0.02)(Cr5.98S0.01P0.01)Si1.97O34H2.16 |
| Masse atomique (u ≡ Da) | 3055.4962 |
| Masse molaire #1 (g.mol-1) | 3055.4962 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 2.16 | 3.92 | 1.00797500 | 2.17722609 | 0.07 |
| O | 34.00 | 61.69 | 15.99940000 | 543.97960000 | 17.80 |
| Mg | 0.02 | 0.04 | 24.30550000 | 0.48610999 | 0.02 |
| Si | 1.97 | 3.57 | 28.08510000 | 55.32764780 | 1.81 |
| P | 0.01 | 0.02 | 30.97376200 | 0.30973761 | 0.01 |
| S | 0.01 | 0.02 | 32.06750000 | 0.32067499 | 0.01 |
| Cr | 5.98 | 10.85 | 51.99616000 | 310.93703779 | 10.18 |
| Zn | 0.91 | 1.65 | 65.38200000 | 59.49762171 | 1.95 |
| Pb | 10.05 | 18.24 | 207.21000000 | 2082.46053952 | 68.15 |
| Total | 55.11 | 100.00 | 3055.49619550 | 100.00 |
| Dureté de Mohs | 3 |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 5.46 |
| Indice de fermions | 0,16 |
| Indice de bosons | 0,84 |
| Photoélectricité | |
| └─ PEHemihedrite (barns/électron) | 1 231,05 |
| └─ U #2 (barns/cm3) | 6 721,533 |
| GRapi #3 | 0 |
| Strunz 9ed. | 07 ▶ Sulfates, sélénates, tellurates, chromates, molybdates, tungstates └─ 07.F ▶ Chromates └─ 07.FC ▶ Avec PO4, AsO4, SiO4 └─ 07.FC.15 ▶ Hemihedrite |
| Dana 8ed. | 36 ▶ Compound Chromates └─ 36.01 ▶ Compound Chromates avec formules diverses └─ 36.01.01 ▶ (Indéfini) └─ 36.01.01.02 ▶ Hemihedrite |
| CIM Hey's | |
| Lapis | VIII ▶ Silicates └─ VIII/B ▶ Inselsilicates avec anions étrangers au tétraèdre (néso-subsilikates) └─ VIII/B.28 ▶ Cations avec nombres de coordination entre [8] et [12] ; silicates en îlots avec groupes [SO4]2-, [CrO4]2- et [PO4]3- └─ VIII/B.28-020 ▶ Hemihedrite |
| Hölzel | 7 ▶ Sulfates, chromates, molybdates, wolframates, tellurates └─ 7.F ▶ Chromates └─ 7.FB.2 ▶ (Indéfini) └─ 7.FB.260 ▶ Hemihedrite |
| Système cristallin | Triclinique |
| └─ Notation Hermann–Mauguin | 1 |
| └─ Règles longueurs | a ≠ b ≠ c |
| └─ Règles angles | α ≠ β ≠ γ ≠ 90° |
| Classe cristalline | Centro-symétrique #5 |
| └─ Notation Hermann–Mauguin | 1 |
| └─ Notation Schoenflies | Ci ≡ S2 |
| └─ Axes binaires (180°) | 0 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | ≥1 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | 2 |
| └─ Notation Hermann–Mauguin | P1 |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 9.497 |
| └─ b (Å) | 11.443 |
| └─ c (Å) | 10.841 |
| Rapport | |
| └─ Rapport a/b | 0.830 |
| └─ Rapport c/a | 1.142 |
| └─ Rapport c/b | 0.947 |
| Angles | |
| └─ α (°) | 120.50 |
| └─ β (°) | 92.10 |
| └─ γ (°) | 55.83 |
| Z #1 | 1 |
| Volume (calculé) #2 (Å3) | 787.241 |
| Densité (calculé) ρ #3 (g/cm3) | 6.445 |
| Système cristallin | Triclinique |
| └─ Angle 2V | Biaxe (+) |
| └─ Angle (°) | 88° |
| └─ Anisotropie | Oui |
| └─ Biréfringence Maxi. | 0.545 |
| └─ Absorption (X/Y/Z) | |
| └─ Pléochroïsme | |
| └─ Pléochroïsme X | |
| └─ Pléochroïsme Y | |
| └─ Pléochroïsme Z | |
| └─ Indice moyen | 2,358 |
| └─ Indice α / ω / n | 2,105 |
| └─ Indice β | 2,32 |
| └─ Indice γ / ε | 2,65 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.1759 |
| └─ KPD calculé | 0.2109 |
| └─ CI #2 calculé | -0,199 ▶ Supérieur |
| └─ KPD mesuré | 0.2116 |
| └─ CI #2 mesuré | -0,203 ▶ Supérieur |
| └─ N calculé | |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/hemihedrite.pdf |
| Mindat | http://www.mindat.org/show.php?name=hemihedrite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=hemihedrite |
| RRUFF | https://rruff.net/hemihedrite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?hemihedrite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=h |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/hemihedrite_foto.html |
| Webmineral | https://webmineral.com/data/Hemihedrite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/hemihedrite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=hemihedrite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/hemihedrite |
| Gem Select | https://www.gemselect.com/hemihedrite/hemihedrite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=hemihedrite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/hemihedrite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/hemihedrite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=hemihedrite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=hemihedrite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=hemihedrite |