| Nom | Attakolite |
| └─ Allemand (de) | Attacolit |
| └─ Allemand (de) | Attakolit |
| └─ Allemand (de) | Attakolith |
| └─ Anglais (en) | Attacolite |
| └─ Anglais (en) | Attakolite |
| └─ Espagnol (es) | Atacolita |
| └─ Espagnol (es) | Attacolita |
| └─ Espagnol (es) | Attakolita |
| └─ Français (fr) | Attakolite |
| └─ Russe (ru) | Аттаколит |
| Origine | Named from the Greek for "salmon" for the pale pink color. |
| Statut | Rd ▶ Redéfini |
| Nom | Attakolite |
| Code | 1992 s.p. |
| Symbole | Ako |
| Formule | CaMn2+Al4(HSiO4)(PO4)3(OH)4 |
| Pays | SWE |
| Météorite | Non |
| Référence 1 | Öfversigt af Kongliga Vetenskaps- Akademiens Förhandlingar 25 (1868), 197 |
| Référence 2 | American Mineralogist 77 (1992), 1285 |
| Archive | 2025-11 |
| Webmineral | (Ca,Sr)Mn++(Al,Fe+++)4[(Si,P)O4]H(PO4)3(OH)4 |
| Mineralienatlas | CaMn2+Al4(HSiO4)(PO4)3(OH)4 |
| Mineralienatlas (Empirique) | CaMnAl4(HSiO4)(PO4)3(OH)4 |
| Rruff | CaMn2+Al4(HSiO4)(PO4)3(OH)4 |
| Formule de référence | CaMnAl4(HSiO4)(PO4)3(OH)4 |
| Masse atomique (u ≡ Da) | 648.9769 |
| Masse molaire #1 (g.mol-1) | 648.9769 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| H | 5.00 | 14.29 | 1.00797500 | 5.03987500 | 0.78 |
| O | 20.00 | 57.14 | 15.99940000 | 319.98800000 | 49.31 |
| Al | 4.00 | 11.43 | 26.98153850 | 107.92615400 | 16.63 |
| Si | 1.00 | 2.86 | 28.08510000 | 28.08510000 | 4.33 |
| P | 3.00 | 8.57 | 30.97376200 | 92.92128600 | 14.32 |
| Ca | 1.00 | 2.86 | 40.07840000 | 40.07840000 | 6.18 |
| Mn | 1.00 | 2.86 | 54.93804400 | 54.93804400 | 8.47 |
| Total | 35.00 | 100.00 | 648.97685900 | 100.00 |
| Dureté de Mohs | |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 3.11 |
| Indice de fermions | 0,004 |
| Indice de bosons | 0,996 |
| Photoélectricité | |
| └─ PEAttakolite (barns/électron) | 7,52 |
| └─ U #2 (barns/cm3) | 23,3872 |
| GRapi #3 | 0 |
| Strunz 9ed. | 08 ▶ Phosphates, arséniates, vanadates └─ 08.B ▶ Phosphates, etc. avec anions additionnels, sans H2O └─ 08.BH ▶ Avec medium-sized and large cations, (OH,etc) : RO4 = 1:1 └─ 08.BH.60 ▶ Attakolite |
| Dana 8ed. | 43 ▶ Compound Phosphates, etc └─ 43.04 ▶ Compound Phosphates, etc (Anhydres Anions composés avec Hydroxyle ou Halogène) └─ 43.04.13 ▶ (Indéfini) └─ 43.04.13.01 ▶ Attakolite |
| CIM Hey's | |
| Lapis | VII ▶ Phosphates et arsénates (« phosphates » incluent toujours les arsénates et les vanadates isotypes) └─ VII/B ▶ Phosphates anhydres, avec anions étrangers F, Cl, O, OH └─ VII/B.28 ▶ Cations moyens et gros : Mg–Cu–Zn et Ca–Na–K–Ba–Pb └─ VII/B.28-030 ▶ Attakolite |
| Hölzel | 8 ▶ Phosphates, arsénates, vanadates └─ 8.B ▶ Phosphates, etc., avec autres anions, sans H2O └─ 8.BL.9 ▶ Avec autres anions complexes : sans O, ni sulfate, ni tellurate └─ 8.BL.940 ▶ Attakolite |
| Système cristallin | Monoclinique |
| └─ Notation Hermann–Mauguin | 2/m |
| └─ Règles longueurs | a ≠ b ≠ c |
| └─ Règles angles | α = γ = 90°, β ≠ 90° |
| Classe cristalline | Monoclinique dipyramidal #5 |
| └─ Notation Hermann–Mauguin | 2/m |
| └─ Notation Schoenflies | C2h |
| └─ Axes binaires (180°) | 1 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 1 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | 12 |
| └─ Notation Hermann–Mauguin | C2/m |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 17.188 |
| └─ b (Å) | 11.477 |
| └─ c (Å) | 7.322 |
| Rapport | |
| └─ Rapport a/b | 1.498 |
| └─ Rapport c/a | 0.426 |
| └─ Rapport c/b | 0.638 |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 113.83 |
| └─ γ (°) | 90 |
| Z #1 | 4 |
| Volume (calculé) #2 (Å3) | 1321.250 |
| Densité (calculé) ρ #3 (g/cm3) | 3.263 |
| Système cristallin | Monoclinique |
| └─ Angle 2V | Biaxe (+) |
| └─ Angle (°) | 75° |
| └─ Anisotropie | Oui |
| └─ Biréfringence Maxi. | 0.011 |
| └─ Absorption (X/Y/Z) | |
| └─ Pléochroïsme | |
| └─ Pléochroïsme X | |
| └─ Pléochroïsme Y | |
| └─ Pléochroïsme Z | |
| └─ Indice moyen | 1,655 |
| └─ Indice α / ω / n | 1,65 |
| └─ Indice β | 1,654 |
| └─ Indice γ / ε | 1,661 |
| Validation Gladstone-Dale | |
| └─ KC #1 | 0.2094 |
| └─ KPD calculé | 0.1964 |
| └─ CI #2 calculé | 0,062 ▶ Correct |
| └─ KPD mesuré | 0.2088 |
| └─ CI #2 mesuré | 0,003 ▶ Excellent |
| └─ N calculé | 1.65 - 1.7 |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/attakolite.pdf |
| Mindat | http://www.mindat.org/show.php?name=attakolite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=attakolite |
| RRUFF | https://rruff.net/attakolite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?attakolite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=a |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/attakolite_foto.html |
| Webmineral | https://webmineral.com/data/Attakolite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/attakolite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=attakolite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/attakolite |
| Gem Select | https://www.gemselect.com/attakolite/attakolite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=attakolite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/attakolite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/attakolite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=attakolite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=attakolite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=attakolite |