| Nom | Levyclaudite |
| └─ Allemand (de) | Lévyclaudit |
| └─ Anglais (en) | Lévyclaudite |
| └─ Espagnol (es) | Lévyclaudita |
| └─ Français (fr) | Lévyclaudite |
| └─ IMA (im) | IMA1989-034 |
| Origine | Named for Claude Levy (1924-), French mineralogist. |
| Statut | A ▶ Approuvé |
| Nom | Lévyclaudite |
| Code | 1989-034 |
| Symbole | Lvc |
| Formule | Pb8Cu3Sn7(Bi,Sb)3S28 |
| Pays | GRC |
| Météorite | Non |
| Référence 1 | European Journal of Mineralogy 2 (1990), 711 |
| Référence 2 | Acta Crystallographica B62 (2006), 775 |
| Archive | 2025-11 |
| Webmineral | Pb8Sn7Cu3(Bi,Sb)3S28 |
| Mineralienatlas | Pb8Sn7Cu3(Bi,Sb)3S28 |
| Mineralienatlas (Empirique) | Pb8Sn7Cu3(Bi0.75Sb0.25)3S28 |
| Rruff | Pb2+8Cu1+3Sn4+7(Bi3+,Sb3+)3S2-28 |
| Formule de référence | Pb8Sn7Cu3(Bi0.75Sb0.25)3S28 |
| Masse atomique (u ≡ Da) | 4138.7098 |
| Masse molaire #1 (g.mol-1) | 4138.7098 |
| Element | Quantité | % Atomes | Masse (u ≡ Da) | Total masse (u ≡ Da) | % Masse |
|---|---|---|---|---|---|
| S | 28.00 | 57.14 | 32.06750000 | 897.89000000 | 21.69 |
| Cu | 3.00 | 6.12 | 63.54630000 | 190.63890000 | 4.61 |
| Sn | 7.00 | 14.29 | 118.71070000 | 830.97490000 | 20.08 |
| Sb | 0.75 | 1.53 | 121.76010000 | 91.32007500 | 2.21 |
| Pb | 8.00 | 16.33 | 207.21000000 | 1657.68000000 | 40.05 |
| Bi | 2.25 | 4.59 | 208.98040000 | 470.20590000 | 11.36 |
| Total | 49.00 | 100.00 | 4138.70977500 | 100.00 |
| Dureté de Mohs | 2,5 - 3 |
| Dureté de Vickers | |
| Densité électronique #1 (g/cm3) | 5.28 |
| Indice de fermions | 0,12 |
| Indice de bosons | 0,88 |
| Photoélectricité | |
| └─ PELevyclaudite (barns/électron) | 1 038,1 |
| └─ U #2 (barns/cm3) | 5 481,168 |
| GRapi #3 | 0 |
| Strunz 9ed. | 02 ▶ Sulfures et sulfosels └─ 02.H ▶ Sulfosalts of SnS Archetype └─ 02.HF ▶ With SnS and PbS archetype structure units └─ 02.HF.25 ▶ Levyclaudite |
| Dana 8ed. | 03 ▶ Sulfures - Sulfosels └─ 03.01 ▶ Sulfures - Sulfosels où z/y > 4 - (A+)i (A2+)j [By Cz], A=metals, B=semi-metals, C=non-metals └─ 03.01.03 ▶ (Indéfini) └─ 03.01.03.01 ▶ Levyclaudite |
| CIM Hey's | |
| Lapis | II ▶ Sulfures et sulfosels (sulfures, séléniures, tellurures, arsénures, antimonures, bismuthures) └─ II/C ▶ Sulfures avec rapport métal : S,Se,Te = 1:1 └─ II/C.17 ▶ (Indéfini) └─ II/C.17-055 ▶ Levyclaudite |
| Hölzel | 2 ▶ Sulfures └─ 2.G ▶ Archétypes SnS └─ 2.GB.4 ▶ Groupe Cylindrite–Franckeite └─ 2.GB.420 ▶ Levyclaudite |
| Système cristallin | |
| └─ Notation Hermann–Mauguin | |
| └─ Règles longueurs | |
| └─ Règles angles | |
| Classe cristalline | |
| └─ Notation Hermann–Mauguin | |
| └─ Notation Schoenflies | |
| └─ Axes binaires (180°) | 0 |
| └─ Axes ternaires (120°) | 0 |
| └─ Axes quaternaires (90°) | 0 |
| └─ Axes senaires (60°) | 0 |
| └─ Plans de symétrie | 0 |
| └─ Inversion centrale | Oui |
| Groupe d'espace | |
| └─ Notation Hermann–Mauguin | |
| Groupe de plan | |
| └─ Notation Hermann–Mauguin | |
| Mailles | |
| └─ a (Å) | 11.84 - |
| └─ b (Å) | 5.825 - |
| └─ c (Å) | 5.831 - |
| Rapport | |
| └─ Rapport a/b | 2.033 |
| └─ Rapport c/a | 0.492 |
| └─ Rapport c/b | 1.001 |
| Angles | |
| └─ α (°) | 90 |
| └─ β (°) | 92.60 |
| └─ γ (°) | 90 |
| Z #1 | 0. |
| Volume (calculé) #2 (Å3) | 401.738 |
| Densité (calculé) ρ #3 (g/cm3) |
| Système cristallin | |
| └─ Angle 2V | |
| └─ Anisotropie | Non |
| └─ Biréfringence Maxi. | |
| └─ Absorption | Aucune |
| └─ Pléochroïsme | Aucun |
| └─ Pléochroïsme X | Aucun |
| └─ Pléochroïsme Y | Aucun |
| └─ Pléochroïsme Z | Aucun |
| └─ Indice moyen | |
| └─ Indice α / ω / n | |
| └─ Indice β | |
| └─ Indice γ / ε | |
| Validation Gladstone-Dale | |
| └─ KC #1 | |
| └─ KPD calculé | |
| └─ CI #2 calculé | |
| └─ KPD mesuré | |
| └─ CI #2 mesuré | |
| └─ N calculé | |
| Opacité |
| UV longs (365 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV moyens (320 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| UV courts (254 nm) | |
| └─ Fréquence | |
| └─ Intesité | |
| └─ Couleurs | |
| └─ Autres couleurs | |
| Fluorescence UV | |
| └─ Activateur principal | |
| └─ Autres activateurs |
| Handbook of mineralogy | https://handbookofmineralogy.org/pdfs/levyclaudite.pdf |
| Mindat | http://www.mindat.org/show.php?name=levyclaudite |
| Mineralienatlas | https://www.mineralienatlas.de/lexikon/index.php/MineralData?mineral=levyclaudite |
| RRUFF | https://rruff.net/levyclaudite |
| Rruff IMA | https://www.rruff.net/ima-mineral-list/?levyclaudite |
| Smorf Crystal Model | https://www.smorf.nl/crystals_az_naam.php?naam=l |
| Strahlen | https://www.strahlen.org/tw/fotoatlas1/levyclaudite_foto.html |
| Webmineral | https://webmineral.com/data/Levyclaudite.shtml |
| 1001 Minéraux | https://1001mineraux.com/collections/levyclaudite |
| Anton Waltz Minerals | https://www.awminerals.com/ |
| e-rocks | https://e-rocks.com/itemssearch?search=levyclaudite&op=Submit&form_id=klondike_search_quick_form |
| FossilEra | https://www.fossilera.com/minerals-for-sale/levyclaudite |
| Gem Select | https://www.gemselect.com/levyclaudite/levyclaudite.php |
| Gemfrance | https://www.gemfrance.com/catalogsearch/result/?q=levyclaudite |
| Le Comptoir Géologique (Gemmes) | https://www.le-comptoir-geologique.com/levyclaudite-gemme.html |
| Le Comptoir Géologique (Minéraux) | https://www.le-comptoir-geologique.com/levyclaudite-mineraux.html |
| Pegmatite | http://pegmatite.ru |
| Shungite.fr (La Roche Mère) | https://shungite.fr/fr/recherche?controller=search&s=levyclaudite |
| The Arkenstone | https://www.irocks.com/search?mode=advanced&query=levyclaudite&status%5B%5D=available&status%5B%5D=on-hold&status%5B%5D=sold |
| Weinrich Minerals | https://www.weinrichmineralsinc.com/product/shop/archive?name=levyclaudite |